const MCExpr *lowerConstant(const Constant *CV);
/// \brief Print a general LLVM constant to the .s file.
- void EmitGlobalConstant(const Constant *CV);
+ void EmitGlobalConstant(const DataLayout &DL, const Constant *CV);
/// \brief Unnamed constant global variables solely contaning a pointer to
/// another globals variable act like a global variable "proxy", or GOT
/// Targets can override this to change how global constants that are part of
/// a C++ static/global constructor list are emitted.
- virtual void EmitXXStructor(const Constant *CV) { EmitGlobalConstant(CV); }
+ virtual void EmitXXStructor(const DataLayout &DL, const Constant *CV) {
+ EmitGlobalConstant(DL, CV);
+ }
/// Return true if the basic block has exactly one predecessor and the control
/// transfer mechanism between the predecessor and this block is a
void EmitLLVMUsedList(const ConstantArray *InitList);
/// Emit llvm.ident metadata in an '.ident' directive.
void EmitModuleIdents(Module &M);
- void EmitXXStructorList(const Constant *List, bool isCtor);
+ void EmitXXStructorList(const DataLayout &DL, const Constant *List,
+ bool isCtor);
GCMetadataPrinter *GetOrCreateGCPrinter(GCStrategy &C);
};
}
return *TM.getObjFileLowering();
}
-/// getDataLayout - Return information about data layout.
const DataLayout &AsmPrinter::getDataLayout() const {
return MMI->getModule()->getDataLayout();
}
-unsigned AsmPrinter::getPointerSize() const { return TM.getDataLayout()->getPointerSize(); }
+unsigned AsmPrinter::getPointerSize() const {
+ return TM.getDataLayout()->getPointerSize();
+}
const MCSubtargetInfo &AsmPrinter::getSubtargetInfo() const {
assert(MF && "getSubtargetInfo requires a valid MachineFunction!");
EmitAlignment(AlignLog, GV);
OutStreamer->EmitLabel(MangSym);
- EmitGlobalConstant(GV->getInitializer());
+ EmitGlobalConstant(GV->getParent()->getDataLayout(),
+ GV->getInitializer());
}
OutStreamer->AddBlankLine();
OutStreamer->EmitLabel(GVSym);
- EmitGlobalConstant(GV->getInitializer());
+ EmitGlobalConstant(GV->getParent()->getDataLayout(), GV->getInitializer());
if (MAI->hasDotTypeDotSizeDirective())
// .size foo, 42
// Emit the prefix data.
if (F->hasPrefixData())
- EmitGlobalConstant(F->getPrefixData());
+ EmitGlobalConstant(F->getParent()->getDataLayout(), F->getPrefixData());
// Emit the CurrentFnSym. This is a virtual function to allow targets to
// do their wild and crazy things as required.
// Emit the prologue data.
if (F->hasPrologueData())
- EmitGlobalConstant(F->getPrologueData());
+ EmitGlobalConstant(F->getParent()->getDataLayout(), F->getPrologueData());
}
/// EmitFunctionEntryLabel - Emit the label that is the entrypoint for the
MachineModuleInfoELF::SymbolListTy Stubs = MMIELF.GetGVStubList();
if (!Stubs.empty()) {
OutStreamer->SwitchSection(TLOF.getDataRelSection());
- const DataLayout *DL = TM.getDataLayout();
+ const DataLayout &DL = M.getDataLayout();
for (const auto &Stub : Stubs) {
OutStreamer->EmitLabel(Stub.first);
OutStreamer->EmitSymbolValue(Stub.second.getPointer(),
- DL->getPointerSize());
+ DL.getPointerSize());
}
}
}
// Emit __morestack address if needed for indirect calls.
if (MMI->usesMorestackAddr()) {
MCSection *ReadOnlySection = getObjFileLowering().getSectionForConstant(
- getDataLayout(), SectionKind::getReadOnly(), /*C=*/nullptr);
+ getDataLayout(), SectionKind::getReadOnly(),
+ /*C=*/nullptr);
OutStreamer->SwitchSection(ReadOnlySection);
MCSymbol *AddrSymbol =
OutContext.getOrCreateSymbol(StringRef("__morestack_addr"));
OutStreamer->EmitLabel(AddrSymbol);
- unsigned PtrSize = TM.getDataLayout()->getPointerSize(0);
+ unsigned PtrSize = M.getDataLayout().getPointerSize(0);
OutStreamer->EmitSymbolValue(GetExternalSymbolSymbol("__morestack"),
PtrSize);
}
const MachineConstantPoolEntry &CPE = CP[i];
unsigned Align = CPE.getAlignment();
- SectionKind Kind =
- CPE.getSectionKind(TM.getDataLayout());
+ SectionKind Kind = CPE.getSectionKind(&getDataLayout());
const Constant *C = nullptr;
if (!CPE.isMachineConstantPoolEntry())
OutStreamer->EmitZeros(NewOffset - Offset);
Type *Ty = CPE.getType();
- Offset = NewOffset +
- TM.getDataLayout()->getTypeAllocSize(Ty);
+ Offset = NewOffset + getDataLayout().getTypeAllocSize(Ty);
OutStreamer->EmitLabel(Sym);
if (CPE.isMachineConstantPoolEntry())
EmitMachineConstantPoolValue(CPE.Val.MachineCPVal);
else
- EmitGlobalConstant(CPE.Val.ConstVal);
+ EmitGlobalConstant(getDataLayout(), CPE.Val.ConstVal);
}
}
}
/// by the current function to the current output stream.
///
void AsmPrinter::EmitJumpTableInfo() {
- const DataLayout *DL = MF->getTarget().getDataLayout();
+ const DataLayout &DL = MF->getDataLayout();
const MachineJumpTableInfo *MJTI = MF->getJumpTableInfo();
if (!MJTI) return;
if (MJTI->getEntryKind() == MachineJumpTableInfo::EK_Inline) return;
OutStreamer->SwitchSection(ReadOnlySection);
}
- EmitAlignment(Log2_32(
- MJTI->getEntryAlignment(*TM.getDataLayout())));
+ EmitAlignment(Log2_32(MJTI->getEntryAlignment(DL)));
// Jump tables in code sections are marked with a data_region directive
// where that's supported.
// before each jump table. The first label is never referenced, but tells
// the assembler and linker the extents of the jump table object. The
// second label is actually referenced by the code.
- if (JTInDiffSection && DL->hasLinkerPrivateGlobalPrefix())
+ if (JTInDiffSection && DL.hasLinkerPrivateGlobalPrefix())
// FIXME: This doesn't have to have any specific name, just any randomly
// named and numbered 'l' label would work. Simplify GetJTISymbol.
OutStreamer->EmitLabel(GetJTISymbol(JTI, true));
assert(Value && "Unknown entry kind!");
- unsigned EntrySize =
- MJTI->getEntrySize(*TM.getDataLayout());
+ unsigned EntrySize = MJTI->getEntrySize(getDataLayout());
OutStreamer->EmitValue(Value, EntrySize);
}
assert(GV->hasInitializer() && "Not a special LLVM global!");
if (GV->getName() == "llvm.global_ctors") {
- EmitXXStructorList(GV->getInitializer(), /* isCtor */ true);
+ EmitXXStructorList(GV->getParent()->getDataLayout(), GV->getInitializer(),
+ /* isCtor */ true);
if (TM.getRelocationModel() == Reloc::Static &&
MAI->hasStaticCtorDtorReferenceInStaticMode()) {
}
if (GV->getName() == "llvm.global_dtors") {
- EmitXXStructorList(GV->getInitializer(), /* isCtor */ false);
+ EmitXXStructorList(GV->getParent()->getDataLayout(), GV->getInitializer(),
+ /* isCtor */ false);
if (TM.getRelocationModel() == Reloc::Static &&
MAI->hasStaticCtorDtorReferenceInStaticMode()) {
/// EmitXXStructorList - Emit the ctor or dtor list taking into account the init
/// priority.
-void AsmPrinter::EmitXXStructorList(const Constant *List, bool isCtor) {
+void AsmPrinter::EmitXXStructorList(const DataLayout &DL, const Constant *List,
+ bool isCtor) {
// Should be an array of '{ int, void ()* }' structs. The first value is the
// init priority.
if (!isa<ConstantArray>(List)) return;
}
// Emit the function pointers in the target-specific order
- const DataLayout *DL = TM.getDataLayout();
- unsigned Align = Log2_32(DL->getPointerPrefAlignment());
+ unsigned Align = Log2_32(DL.getPointerPrefAlignment());
std::stable_sort(Structors.begin(), Structors.end(),
[](const Structor &L,
const Structor &R) { return L.Priority < R.Priority; });
OutStreamer->SwitchSection(OutputSection);
if (OutStreamer->getCurrentSection() != OutStreamer->getPreviousSection())
EmitAlignment(Align);
- EmitXXStructor(S.Func);
+ EmitXXStructor(DL, S.Func);
}
}
//
void AsmPrinter::EmitAlignment(unsigned NumBits, const GlobalObject *GV) const {
if (GV)
- NumBits = getGVAlignmentLog2(GV, *TM.getDataLayout(),
- NumBits);
+ NumBits = getGVAlignmentLog2(GV, GV->getParent()->getDataLayout(), NumBits);
if (NumBits == 0) return; // 1-byte aligned: no need to emit alignment.
// If the code isn't optimized, there may be outstanding folding
// opportunities. Attempt to fold the expression using DataLayout as a
// last resort before giving up.
- if (Constant *C = ConstantFoldConstantExpression(CE, *TM.getDataLayout()))
+ if (Constant *C = ConstantFoldConstantExpression(CE, getDataLayout()))
if (C != CE)
return lowerConstant(C);
report_fatal_error(OS.str());
}
case Instruction::GetElementPtr: {
- const DataLayout &DL = *TM.getDataLayout();
-
// Generate a symbolic expression for the byte address
- APInt OffsetAI(DL.getPointerTypeSizeInBits(CE->getType()), 0);
- cast<GEPOperator>(CE)->accumulateConstantOffset(DL, OffsetAI);
+ APInt OffsetAI(getDataLayout().getPointerTypeSizeInBits(CE->getType()), 0);
+ cast<GEPOperator>(CE)->accumulateConstantOffset(getDataLayout(), OffsetAI);
const MCExpr *Base = lowerConstant(CE->getOperand(0));
if (!OffsetAI)
return lowerConstant(CE->getOperand(0));
case Instruction::IntToPtr: {
- const DataLayout &DL = *TM.getDataLayout();
+ const DataLayout &DL = getDataLayout();
// Handle casts to pointers by changing them into casts to the appropriate
// integer type. This promotes constant folding and simplifies this code.
}
case Instruction::PtrToInt: {
- const DataLayout &DL = *TM.getDataLayout();
+ const DataLayout &DL = getDataLayout();
// Support only foldable casts to/from pointers that can be eliminated by
// changing the pointer to the appropriately sized integer type.
}
}
-static void emitGlobalConstantImpl(const Constant *C, AsmPrinter &AP,
+static void emitGlobalConstantImpl(const DataLayout &DL, const Constant *C,
+ AsmPrinter &AP,
const Constant *BaseCV = nullptr,
uint64_t Offset = 0);
/// isRepeatedByteSequence - Determine whether the given value is
/// composed of a repeated sequence of identical bytes and return the
/// byte value. If it is not a repeated sequence, return -1.
-static int isRepeatedByteSequence(const Value *V, TargetMachine &TM) {
+static int isRepeatedByteSequence(const Value *V, const DataLayout &DL) {
if (const ConstantInt *CI = dyn_cast<ConstantInt>(V)) {
- uint64_t Size = TM.getDataLayout()->getTypeAllocSizeInBits(V->getType());
+ uint64_t Size = DL.getTypeAllocSizeInBits(V->getType());
assert(Size % 8 == 0);
// Extend the element to take zero padding into account.
// byte.
assert(CA->getNumOperands() != 0 && "Should be a CAZ");
Constant *Op0 = CA->getOperand(0);
- int Byte = isRepeatedByteSequence(Op0, TM);
+ int Byte = isRepeatedByteSequence(Op0, DL);
if (Byte == -1)
return -1;
return -1;
}
-static void emitGlobalConstantDataSequential(const ConstantDataSequential *CDS,
- AsmPrinter &AP){
+static void emitGlobalConstantDataSequential(const DataLayout &DL,
+ const ConstantDataSequential *CDS,
+ AsmPrinter &AP) {
// See if we can aggregate this into a .fill, if so, emit it as such.
- int Value = isRepeatedByteSequence(CDS, AP.TM);
+ int Value = isRepeatedByteSequence(CDS, DL);
if (Value != -1) {
- uint64_t Bytes =
- AP.TM.getDataLayout()->getTypeAllocSize(
- CDS->getType());
+ uint64_t Bytes = DL.getTypeAllocSize(CDS->getType());
// Don't emit a 1-byte object as a .fill.
if (Bytes > 1)
return AP.OutStreamer->EmitFill(Bytes, Value);
}
}
- const DataLayout &DL = *AP.TM.getDataLayout();
unsigned Size = DL.getTypeAllocSize(CDS->getType());
unsigned EmittedSize = DL.getTypeAllocSize(CDS->getType()->getElementType()) *
CDS->getNumElements();
}
-static void emitGlobalConstantArray(const ConstantArray *CA, AsmPrinter &AP,
+static void emitGlobalConstantArray(const DataLayout &DL,
+ const ConstantArray *CA, AsmPrinter &AP,
const Constant *BaseCV, uint64_t Offset) {
// See if we can aggregate some values. Make sure it can be
// represented as a series of bytes of the constant value.
- int Value = isRepeatedByteSequence(CA, AP.TM);
- const DataLayout &DL = *AP.TM.getDataLayout();
+ int Value = isRepeatedByteSequence(CA, DL);
if (Value != -1) {
uint64_t Bytes = DL.getTypeAllocSize(CA->getType());
}
else {
for (unsigned i = 0, e = CA->getNumOperands(); i != e; ++i) {
- emitGlobalConstantImpl(CA->getOperand(i), AP, BaseCV, Offset);
+ emitGlobalConstantImpl(DL, CA->getOperand(i), AP, BaseCV, Offset);
Offset += DL.getTypeAllocSize(CA->getOperand(i)->getType());
}
}
}
-static void emitGlobalConstantVector(const ConstantVector *CV, AsmPrinter &AP) {
+static void emitGlobalConstantVector(const DataLayout &DL,
+ const ConstantVector *CV, AsmPrinter &AP) {
for (unsigned i = 0, e = CV->getType()->getNumElements(); i != e; ++i)
- emitGlobalConstantImpl(CV->getOperand(i), AP);
+ emitGlobalConstantImpl(DL, CV->getOperand(i), AP);
- const DataLayout &DL = *AP.TM.getDataLayout();
unsigned Size = DL.getTypeAllocSize(CV->getType());
unsigned EmittedSize = DL.getTypeAllocSize(CV->getType()->getElementType()) *
CV->getType()->getNumElements();
AP.OutStreamer->EmitZeros(Padding);
}
-static void emitGlobalConstantStruct(const ConstantStruct *CS, AsmPrinter &AP,
+static void emitGlobalConstantStruct(const DataLayout &DL,
+ const ConstantStruct *CS, AsmPrinter &AP,
const Constant *BaseCV, uint64_t Offset) {
// Print the fields in successive locations. Pad to align if needed!
- const DataLayout *DL = AP.TM.getDataLayout();
- unsigned Size = DL->getTypeAllocSize(CS->getType());
- const StructLayout *Layout = DL->getStructLayout(CS->getType());
+ unsigned Size = DL.getTypeAllocSize(CS->getType());
+ const StructLayout *Layout = DL.getStructLayout(CS->getType());
uint64_t SizeSoFar = 0;
for (unsigned i = 0, e = CS->getNumOperands(); i != e; ++i) {
const Constant *Field = CS->getOperand(i);
// Print the actual field value.
- emitGlobalConstantImpl(Field, AP, BaseCV, Offset+SizeSoFar);
+ emitGlobalConstantImpl(DL, Field, AP, BaseCV, Offset + SizeSoFar);
// Check if padding is needed and insert one or more 0s.
- uint64_t FieldSize = DL->getTypeAllocSize(Field->getType());
+ uint64_t FieldSize = DL.getTypeAllocSize(Field->getType());
uint64_t PadSize = ((i == e-1 ? Size : Layout->getElementOffset(i+1))
- Layout->getElementOffset(i)) - FieldSize;
SizeSoFar += FieldSize + PadSize;
// PPC's long double has odd notions of endianness compared to how LLVM
// handles it: p[0] goes first for *big* endian on PPC.
- if (AP.TM.getDataLayout()->isBigEndian() &&
- !CFP->getType()->isPPC_FP128Ty()) {
+ if (AP.getDataLayout().isBigEndian() && !CFP->getType()->isPPC_FP128Ty()) {
int Chunk = API.getNumWords() - 1;
if (TrailingBytes)
}
// Emit the tail padding for the long double.
- const DataLayout &DL = *AP.TM.getDataLayout();
+ const DataLayout &DL = AP.getDataLayout();
AP.OutStreamer->EmitZeros(DL.getTypeAllocSize(CFP->getType()) -
DL.getTypeStoreSize(CFP->getType()));
}
static void emitGlobalConstantLargeInt(const ConstantInt *CI, AsmPrinter &AP) {
- const DataLayout *DL = AP.TM.getDataLayout();
+ const DataLayout &DL = AP.getDataLayout();
unsigned BitWidth = CI->getBitWidth();
// Copy the value as we may massage the layout for constants whose bit width
// Big endian:
// * Record the extra bits to emit.
// * Realign the raw data to emit the chunks of 64-bits.
- if (DL->isBigEndian()) {
+ if (DL.isBigEndian()) {
// Basically the structure of the raw data is a chunk of 64-bits cells:
// 0 1 BitWidth / 64
// [chunk1][chunk2] ... [chunkN].
// quantities at a time.
const uint64_t *RawData = Realigned.getRawData();
for (unsigned i = 0, e = BitWidth / 64; i != e; ++i) {
- uint64_t Val = DL->isBigEndian() ? RawData[e - i - 1] : RawData[i];
+ uint64_t Val = DL.isBigEndian() ? RawData[e - i - 1] : RawData[i];
AP.OutStreamer->EmitIntValue(Val, 8);
}
// Emit the extra bits after the 64-bits chunks.
// Emit a directive that fills the expected size.
- uint64_t Size = AP.TM.getDataLayout()->getTypeAllocSize(
- CI->getType());
+ uint64_t Size = AP.getDataLayout().getTypeAllocSize(CI->getType());
Size -= (BitWidth / 64) * 8;
assert(Size && Size * 8 >= ExtraBitsSize &&
(ExtraBits & (((uint64_t)-1) >> (64 - ExtraBitsSize)))
AP.GlobalGOTEquivs[GOTEquivSym] = std::make_pair(GV, NumUses);
}
-static void emitGlobalConstantImpl(const Constant *CV, AsmPrinter &AP,
- const Constant *BaseCV, uint64_t Offset) {
- const DataLayout *DL = AP.TM.getDataLayout();
- uint64_t Size = DL->getTypeAllocSize(CV->getType());
+static void emitGlobalConstantImpl(const DataLayout &DL, const Constant *CV,
+ AsmPrinter &AP, const Constant *BaseCV,
+ uint64_t Offset) {
+ uint64_t Size = DL.getTypeAllocSize(CV->getType());
// Globals with sub-elements such as combinations of arrays and structs
// are handled recursively by emitGlobalConstantImpl. Keep track of the
}
if (const ConstantDataSequential *CDS = dyn_cast<ConstantDataSequential>(CV))
- return emitGlobalConstantDataSequential(CDS, AP);
+ return emitGlobalConstantDataSequential(DL, CDS, AP);
if (const ConstantArray *CVA = dyn_cast<ConstantArray>(CV))
- return emitGlobalConstantArray(CVA, AP, BaseCV, Offset);
+ return emitGlobalConstantArray(DL, CVA, AP, BaseCV, Offset);
if (const ConstantStruct *CVS = dyn_cast<ConstantStruct>(CV))
- return emitGlobalConstantStruct(CVS, AP, BaseCV, Offset);
+ return emitGlobalConstantStruct(DL, CVS, AP, BaseCV, Offset);
if (const ConstantExpr *CE = dyn_cast<ConstantExpr>(CV)) {
// Look through bitcasts, which might not be able to be MCExpr'ized (e.g. of
// vectors).
if (CE->getOpcode() == Instruction::BitCast)
- return emitGlobalConstantImpl(CE->getOperand(0), AP);
+ return emitGlobalConstantImpl(DL, CE->getOperand(0), AP);
if (Size > 8) {
// If the constant expression's size is greater than 64-bits, then we have
// to emit the value in chunks. Try to constant fold the value and emit it
// that way.
- Constant *New = ConstantFoldConstantExpression(CE, *DL);
+ Constant *New = ConstantFoldConstantExpression(CE, DL);
if (New && New != CE)
- return emitGlobalConstantImpl(New, AP);
+ return emitGlobalConstantImpl(DL, New, AP);
}
}
if (const ConstantVector *V = dyn_cast<ConstantVector>(CV))
- return emitGlobalConstantVector(V, AP);
+ return emitGlobalConstantVector(DL, V, AP);
// Otherwise, it must be a ConstantExpr. Lower it to an MCExpr, then emit it
// thread the streamer with EmitValue.
}
/// EmitGlobalConstant - Print a general LLVM constant to the .s file.
-void AsmPrinter::EmitGlobalConstant(const Constant *CV) {
- uint64_t Size =
- TM.getDataLayout()->getTypeAllocSize(CV->getType());
+void AsmPrinter::EmitGlobalConstant(const DataLayout &DL, const Constant *CV) {
+ uint64_t Size = DL.getTypeAllocSize(CV->getType());
if (Size)
- emitGlobalConstantImpl(CV, *this);
+ emitGlobalConstantImpl(DL, CV, *this);
else if (MAI->hasSubsectionsViaSymbols()) {
// If the global has zero size, emit a single byte so that two labels don't
// look like they are at the same location.
/// GetCPISymbol - Return the symbol for the specified constant pool entry.
MCSymbol *AsmPrinter::GetCPISymbol(unsigned CPID) const {
- const DataLayout *DL = TM.getDataLayout();
- return OutContext.getOrCreateSymbol
- (Twine(DL->getPrivateGlobalPrefix()) + "CPI" + Twine(getFunctionNumber())
- + "_" + Twine(CPID));
+ const DataLayout &DL = getDataLayout();
+ return OutContext.getOrCreateSymbol(Twine(DL.getPrivateGlobalPrefix()) +
+ "CPI" + Twine(getFunctionNumber()) + "_" +
+ Twine(CPID));
}
/// GetJTISymbol - Return the symbol for the specified jump table entry.
/// GetJTSetSymbol - Return the symbol for the specified jump table .set
/// FIXME: privatize to AsmPrinter.
MCSymbol *AsmPrinter::GetJTSetSymbol(unsigned UID, unsigned MBBID) const {
- const DataLayout *DL = TM.getDataLayout();
- return OutContext.getOrCreateSymbol
- (Twine(DL->getPrivateGlobalPrefix()) + Twine(getFunctionNumber()) + "_" +
- Twine(UID) + "_set_" + Twine(MBBID));
+ const DataLayout &DL = getDataLayout();
+ return OutContext.getOrCreateSymbol(Twine(DL.getPrivateGlobalPrefix()) +
+ Twine(getFunctionNumber()) + "_" +
+ Twine(UID) + "_set_" + Twine(MBBID));
}
MCSymbol *AsmPrinter::getSymbolWithGlobalValueBase(const GlobalValue *GV,
/// Return the MCSymbol for the specified ExternalSymbol.
MCSymbol *AsmPrinter::GetExternalSymbolSymbol(StringRef Sym) const {
SmallString<60> NameStr;
- Mangler::getNameWithPrefix(NameStr, Sym, *TM.getDataLayout());
+ Mangler::getNameWithPrefix(NameStr, Sym, getDataLayout());
return OutContext.getOrCreateSymbol(NameStr);
}
default:
llvm_unreachable("Invalid encoded value.");
case dwarf::DW_EH_PE_absptr:
- return TM.getDataLayout()->getPointerSize();
+ return MF->getDataLayout().getPointerSize();
case dwarf::DW_EH_PE_udata2:
return 2;
case dwarf::DW_EH_PE_udata4:
/// for their own strange codes.
void AsmPrinter::PrintSpecial(const MachineInstr *MI, raw_ostream &OS,
const char *Code) const {
- const DataLayout *DL = TM.getDataLayout();
if (!strcmp(Code, "private")) {
- OS << DL->getPrivateGlobalPrefix();
+ const DataLayout &DL = MF->getDataLayout();
+ OS << DL.getPrivateGlobalPrefix();
} else if (!strcmp(Code, "comment")) {
OS << MAI->getCommentString();
} else if (!strcmp(Code, "uid")) {
void ErlangGCPrinter::finishAssembly(Module &M, GCModuleInfo &Info,
AsmPrinter &AP) {
MCStreamer &OS = *AP.OutStreamer;
- unsigned IntPtrSize = AP.TM.getDataLayout()->getPointerSize();
+ unsigned IntPtrSize = M.getDataLayout().getPointerSize();
// Put this in a custom .note section.
OS.SwitchSection(
///
void OcamlGCMetadataPrinter::finishAssembly(Module &M, GCModuleInfo &Info,
AsmPrinter &AP) {
- unsigned IntPtrSize = AP.TM.getDataLayout()->getPointerSize();
+ unsigned IntPtrSize = M.getDataLayout().getPointerSize();
AP.OutStreamer->SwitchSection(AP.getObjFileLowering().getTextSection());
EmitCamlGlobal(M, AP, "code_end");
BarrierChain = SU;
// This is a barrier event that acts as a pivotal node in the DAG,
// so it is safe to clear list of exposed nodes.
- adjustChainDeps(AA, MFI, *TM.getDataLayout(), SU, &ExitSU, RejectMemNodes,
+ adjustChainDeps(AA, MFI, MF.getDataLayout(), SU, &ExitSU, RejectMemNodes,
TrueMemOrderLatency);
RejectMemNodes.clear();
NonAliasMemDefs.clear();
unsigned ChainLatency = 0;
if (AliasChain->getInstr()->mayLoad())
ChainLatency = TrueMemOrderLatency;
- addChainDependency(AAForDep, MFI, *TM.getDataLayout(), SU, AliasChain,
+ addChainDependency(AAForDep, MFI, MF.getDataLayout(), SU, AliasChain,
RejectMemNodes, ChainLatency);
}
AliasChain = SU;
for (unsigned k = 0, m = PendingLoads.size(); k != m; ++k)
- addChainDependency(AAForDep, MFI, *TM.getDataLayout(), SU,
+ addChainDependency(AAForDep, MFI, MF.getDataLayout(), SU,
PendingLoads[k], RejectMemNodes,
TrueMemOrderLatency);
for (MapVector<ValueType, std::vector<SUnit *> >::iterator I =
AliasMemDefs.begin(), E = AliasMemDefs.end(); I != E; ++I) {
for (unsigned i = 0, e = I->second.size(); i != e; ++i)
- addChainDependency(AAForDep, MFI, *TM.getDataLayout(), SU,
+ addChainDependency(AAForDep, MFI, MF.getDataLayout(), SU,
I->second[i], RejectMemNodes);
}
for (MapVector<ValueType, std::vector<SUnit *> >::iterator I =
AliasMemUses.begin(), E = AliasMemUses.end(); I != E; ++I) {
for (unsigned i = 0, e = I->second.size(); i != e; ++i)
- addChainDependency(AAForDep, MFI, *TM.getDataLayout(), SU,
+ addChainDependency(AAForDep, MFI, MF.getDataLayout(), SU,
I->second[i], RejectMemNodes, TrueMemOrderLatency);
}
- adjustChainDeps(AA, MFI, *TM.getDataLayout(), SU, &ExitSU, RejectMemNodes,
+ adjustChainDeps(AA, MFI, MF.getDataLayout(), SU, &ExitSU, RejectMemNodes,
TrueMemOrderLatency);
PendingLoads.clear();
AliasMemDefs.clear();
BarrierChain->addPred(SDep(SU, SDep::Barrier));
UnderlyingObjectsVector Objs;
- getUnderlyingObjectsForInstr(MI, MFI, Objs, *TM.getDataLayout());
+ getUnderlyingObjectsForInstr(MI, MFI, Objs, MF.getDataLayout());
if (Objs.empty()) {
// Treat all other stores conservatively.
((ThisMayAlias) ? AliasMemDefs.end() : NonAliasMemDefs.end());
if (I != IE) {
for (unsigned i = 0, e = I->second.size(); i != e; ++i)
- addChainDependency(AAForDep, MFI, *TM.getDataLayout(), SU,
+ addChainDependency(AAForDep, MFI, MF.getDataLayout(), SU,
I->second[i], RejectMemNodes, 0, true);
// If we're not using AA, then we only need one store per object.
((ThisMayAlias) ? AliasMemUses.end() : NonAliasMemUses.end());
if (J != JE) {
for (unsigned i = 0, e = J->second.size(); i != e; ++i)
- addChainDependency(AAForDep, MFI, *TM.getDataLayout(), SU,
+ addChainDependency(AAForDep, MFI, MF.getDataLayout(), SU,
J->second[i], RejectMemNodes,
TrueMemOrderLatency, true);
J->second.clear();
// Add dependencies from all the PendingLoads, i.e. loads
// with no underlying object.
for (unsigned k = 0, m = PendingLoads.size(); k != m; ++k)
- addChainDependency(AAForDep, MFI, *TM.getDataLayout(), SU,
+ addChainDependency(AAForDep, MFI, MF.getDataLayout(), SU,
PendingLoads[k], RejectMemNodes,
TrueMemOrderLatency);
// Add dependence on alias chain, if needed.
if (AliasChain)
- addChainDependency(AAForDep, MFI, *TM.getDataLayout(), SU, AliasChain,
+ addChainDependency(AAForDep, MFI, MF.getDataLayout(), SU, AliasChain,
RejectMemNodes);
}
- adjustChainDeps(AA, MFI, *TM.getDataLayout(), SU, &ExitSU, RejectMemNodes,
+ adjustChainDeps(AA, MFI, MF.getDataLayout(), SU, &ExitSU, RejectMemNodes,
TrueMemOrderLatency);
} else if (MI->mayLoad()) {
bool MayAlias = true;
// Invariant load, no chain dependencies needed!
} else {
UnderlyingObjectsVector Objs;
- getUnderlyingObjectsForInstr(MI, MFI, Objs, *TM.getDataLayout());
+ getUnderlyingObjectsForInstr(MI, MFI, Objs, MF.getDataLayout());
if (Objs.empty()) {
// A load with no underlying object. Depend on all
for (MapVector<ValueType, std::vector<SUnit *> >::iterator I =
AliasMemDefs.begin(), E = AliasMemDefs.end(); I != E; ++I)
for (unsigned i = 0, e = I->second.size(); i != e; ++i)
- addChainDependency(AAForDep, MFI, *TM.getDataLayout(), SU,
+ addChainDependency(AAForDep, MFI, MF.getDataLayout(), SU,
I->second[i], RejectMemNodes);
PendingLoads.push_back(SU);
((ThisMayAlias) ? AliasMemDefs.end() : NonAliasMemDefs.end());
if (I != IE)
for (unsigned i = 0, e = I->second.size(); i != e; ++i)
- addChainDependency(AAForDep, MFI, *TM.getDataLayout(), SU,
+ addChainDependency(AAForDep, MFI, MF.getDataLayout(), SU,
I->second[i], RejectMemNodes, 0, true);
if (ThisMayAlias)
AliasMemUses[V].push_back(SU);
NonAliasMemUses[V].push_back(SU);
}
if (MayAlias)
- adjustChainDeps(AA, MFI, *TM.getDataLayout(), SU, &ExitSU,
+ adjustChainDeps(AA, MFI, MF.getDataLayout(), SU, &ExitSU,
RejectMemNodes, /*Latency=*/0);
// Add dependencies on alias and barrier chains, if needed.
if (MayAlias && AliasChain)
- addChainDependency(AAForDep, MFI, *TM.getDataLayout(), SU, AliasChain,
+ addChainDependency(AAForDep, MFI, MF.getDataLayout(), SU, AliasChain,
RejectMemNodes);
if (BarrierChain)
BarrierChain->addPred(SDep(SU, SDep::Barrier));
// throughout the function's lifetime.
bool isInvariant = I.getMetadata(LLVMContext::MD_invariant_load) != nullptr &&
- isDereferenceablePointer(SV, *DAG.getTarget().getDataLayout());
+ isDereferenceablePointer(SV, DAG.getDataLayout());
unsigned Alignment = I.getAlignment();
AAMDNodes AAInfo;
default:
llvm_unreachable("Unrecognized operand type.");
case StackMaps::DirectMemRefOp: {
- unsigned Size = AP.TM.getDataLayout()->getPointerSizeInBits();
+ auto &DL = AP.MF->getDataLayout();
+
+ unsigned Size = DL.getPointerSizeInBits();
assert((Size % 8) == 0 && "Need pointer size in bytes.");
Size /= 8;
unsigned Reg = (++MOI)->getReg();
assert(RC->getSize() >= (Offset + Size) && "bad subregister range");
- if (!MF.getTarget().getDataLayout()->isLittleEndian()) {
+ if (!MF.getDataLayout().isLittleEndian()) {
Offset = RC->getSize() - (Offset + Size);
}
return true;
}
MachineMemOperand *MMO = MF.getMachineMemOperand(
MachinePointerInfo::getFixedStack(FI), Flags,
- TM.getDataLayout()->getPointerSize(), MFI.getObjectAlignment(FI));
+ MF.getDataLayout().getPointerSize(), MFI.getObjectAlignment(FI));
MIB->addMemOperand(MF, MMO);
// Replace the instruction and update the operand index.
MVT LocVT, ISD::ArgFlagsTy &ArgFlags,
CCState &State, unsigned SlotAlign) {
unsigned Size = LocVT.getSizeInBits() / 8;
- unsigned StackAlign = State.getMachineFunction()
- .getTarget()
- .getDataLayout()
- ->getStackAlignment();
+ unsigned StackAlign =
+ State.getMachineFunction().getDataLayout().getStackAlignment();
unsigned Align = std::min(ArgFlags.getOrigAlign(), StackAlign);
for (auto &It : PendingMembers) {
CCIf<!strconcat("ArgFlags.getOrigAlign() == ", Align), A>;
/// CCIfBigEndian - Match only if we're in big endian mode.
class CCIfBigEndian<CCAction A> :
- CCIf<"State.getMachineFunction().getTarget().getDataLayout()->isBigEndian()", A>;
+ CCIf<"State.getMachineFunction().getDataLayout().isBigEndian()", A>;
//===----------------------------------------------------------------------===//
// ARM AAPCS64 Calling Convention
if (CSI.empty())
return;
- const DataLayout *TD = MF.getTarget().getDataLayout();
+ const DataLayout &TD = MF.getDataLayout();
bool HasFP = hasFP(MF);
// Calculate amount of bytes used for return address storing.
- int stackGrowth = -TD->getPointerSize(0);
+ int stackGrowth = -TD.getPointerSize(0);
// Calculate offsets.
int64_t saveAreaOffset = (HasFP ? 2 : 1) * stackGrowth;
}
if (needsFrameMoves) {
- const DataLayout *TD = MF.getTarget().getDataLayout();
- const int StackGrowth = -TD->getPointerSize(0);
+ const DataLayout &TD = MF.getDataLayout();
+ const int StackGrowth = -TD.getPointerSize(0);
unsigned FramePtr = RegInfo->getFrameRegister(MF);
// An example of the prologue:
//
OutStreamer->EmitLabel(CurrentFnSym);
}
-void ARMAsmPrinter::EmitXXStructor(const Constant *CV) {
- uint64_t Size = TM.getDataLayout()->getTypeAllocSize(CV->getType());
+void ARMAsmPrinter::EmitXXStructor(const DataLayout &DL, const Constant *CV) {
+ uint64_t Size = getDataLayout().getTypeAllocSize(CV->getType());
assert(Size && "C++ constructor pointer had zero size!");
const GlobalValue *GV = dyn_cast<GlobalValue>(CV->stripPointerCasts());
MCSymbol *ARMAsmPrinter::
GetARMJTIPICJumpTableLabel(unsigned uid) const {
- const DataLayout *DL = TM.getDataLayout();
+ const DataLayout &DL = getDataLayout();
SmallString<60> Name;
- raw_svector_ostream(Name) << DL->getPrivateGlobalPrefix() << "JTI"
+ raw_svector_ostream(Name) << DL.getPrivateGlobalPrefix() << "JTI"
<< getFunctionNumber() << '_' << uid;
return OutContext.getOrCreateSymbol(Name);
}
MCSymbol *ARMAsmPrinter::GetARMSJLJEHLabel() const {
- const DataLayout *DL = TM.getDataLayout();
+ const DataLayout &DL = getDataLayout();
SmallString<60> Name;
- raw_svector_ostream(Name) << DL->getPrivateGlobalPrefix() << "SJLJEH"
- << getFunctionNumber();
+ raw_svector_ostream(Name) << DL.getPrivateGlobalPrefix() << "SJLJEH"
+ << getFunctionNumber();
return OutContext.getOrCreateSymbol(Name);
}
void ARMAsmPrinter::
EmitMachineConstantPoolValue(MachineConstantPoolValue *MCPV) {
- const DataLayout *DL = TM.getDataLayout();
- int Size = TM.getDataLayout()->getTypeAllocSize(MCPV->getType());
+ const DataLayout &DL = getDataLayout();
+ int Size = DL.getTypeAllocSize(MCPV->getType());
ARMConstantPoolValue *ACPV = static_cast<ARMConstantPoolValue*>(MCPV);
OutContext);
if (ACPV->getPCAdjustment()) {
- MCSymbol *PCLabel = getPICLabel(DL->getPrivateGlobalPrefix(),
- getFunctionNumber(),
- ACPV->getLabelId(),
- OutContext);
+ MCSymbol *PCLabel =
+ getPICLabel(DL.getPrivateGlobalPrefix(), getFunctionNumber(),
+ ACPV->getLabelId(), OutContext);
const MCExpr *PCRelExpr = MCSymbolRefExpr::create(PCLabel, OutContext);
PCRelExpr =
MCBinaryExpr::createAdd(PCRelExpr,
#include "ARMGenMCPseudoLowering.inc"
void ARMAsmPrinter::EmitInstruction(const MachineInstr *MI) {
- const DataLayout *DL = TM.getDataLayout();
+ const DataLayout &DL = getDataLayout();
// If we just ended a constant pool, mark it as such.
if (InConstantPool && MI->getOpcode() != ARM::CONSTPOOL_ENTRY) {
MCSymbol *GVSym = GetARMGVSymbol(GV, TF);
const MCExpr *GVSymExpr = MCSymbolRefExpr::create(GVSym, OutContext);
- MCSymbol *LabelSym = getPICLabel(DL->getPrivateGlobalPrefix(),
- getFunctionNumber(),
- MI->getOperand(2).getImm(), OutContext);
+ MCSymbol *LabelSym =
+ getPICLabel(DL.getPrivateGlobalPrefix(), getFunctionNumber(),
+ MI->getOperand(2).getImm(), OutContext);
const MCExpr *LabelSymExpr= MCSymbolRefExpr::create(LabelSym, OutContext);
unsigned PCAdj = (Opc == ARM::MOVi16_ga_pcrel) ? 8 : 4;
const MCExpr *PCRelExpr =
MCSymbol *GVSym = GetARMGVSymbol(GV, TF);
const MCExpr *GVSymExpr = MCSymbolRefExpr::create(GVSym, OutContext);
- MCSymbol *LabelSym = getPICLabel(DL->getPrivateGlobalPrefix(),
- getFunctionNumber(),
- MI->getOperand(3).getImm(), OutContext);
+ MCSymbol *LabelSym =
+ getPICLabel(DL.getPrivateGlobalPrefix(), getFunctionNumber(),
+ MI->getOperand(3).getImm(), OutContext);
const MCExpr *LabelSymExpr= MCSymbolRefExpr::create(LabelSym, OutContext);
unsigned PCAdj = (Opc == ARM::MOVTi16_ga_pcrel) ? 8 : 4;
const MCExpr *PCRelExpr =
// This adds the address of LPC0 to r0.
// Emit the label.
- OutStreamer->EmitLabel(getPICLabel(DL->getPrivateGlobalPrefix(),
+ OutStreamer->EmitLabel(getPICLabel(DL.getPrivateGlobalPrefix(),
getFunctionNumber(),
- MI->getOperand(2).getImm(),
- OutContext));
+ MI->getOperand(2).getImm(), OutContext));
// Form and emit the add.
EmitToStreamer(*OutStreamer, MCInstBuilder(ARM::tADDhirr)
// This adds the address of LPC0 to r0.
// Emit the label.
- OutStreamer->EmitLabel(getPICLabel(DL->getPrivateGlobalPrefix(),
+ OutStreamer->EmitLabel(getPICLabel(DL.getPrivateGlobalPrefix(),
getFunctionNumber(),
- MI->getOperand(2).getImm(),
- OutContext));
+ MI->getOperand(2).getImm(), OutContext));
// Form and emit the add.
EmitToStreamer(*OutStreamer, MCInstBuilder(ARM::ADDrr)
// a PC-relative address at the ldr instruction.
// Emit the label.
- OutStreamer->EmitLabel(getPICLabel(DL->getPrivateGlobalPrefix(),
+ OutStreamer->EmitLabel(getPICLabel(DL.getPrivateGlobalPrefix(),
getFunctionNumber(),
- MI->getOperand(2).getImm(),
- OutContext));
+ MI->getOperand(2).getImm(), OutContext));
// Form and emit the load
unsigned Opcode;
if (MCPE.isMachineConstantPoolEntry())
EmitMachineConstantPoolValue(MCPE.Val.MachineCPVal);
else
- EmitGlobalConstant(MCPE.Val.ConstVal);
+ EmitGlobalConstant(DL, MCPE.Val.ConstVal);
return;
}
case ARM::JUMPTABLE_ADDRS:
void EmitFunctionEntryLabel() override;
void EmitStartOfAsmFile(Module &M) override;
void EmitEndOfAsmFile(Module &M) override;
- void EmitXXStructor(const Constant *CV) override;
+ void EmitXXStructor(const DataLayout &DL, const Constant *CV) override;
// lowerOperand - Convert a MachineOperand into the equivalent MCOperand.
bool lowerOperand(const MachineOperand &MO, MCOperand &MCOp);
// identity mapping of CPI's to CPE's.
const std::vector<MachineConstantPoolEntry> &CPs = MCP->getConstants();
- const DataLayout &TD = *MF->getTarget().getDataLayout();
+ const DataLayout &TD = MF->getDataLayout();
for (unsigned i = 0, e = CPs.size(); i != e; ++i) {
unsigned Size = TD.getTypeAllocSize(CPs[i].getType());
assert(Size >= 4 && "Too small constant pool entry");
ARMConstantPoolValue *CPV = ARMConstantPoolSymbol::Create(
*Context, "_GLOBAL_OFFSET_TABLE_", ARMPCLabelIndex, PCAdj);
- unsigned Align = TM.getDataLayout()->getPrefTypeAlignment(
+ unsigned Align = MF.getDataLayout().getPrefTypeAlignment(
Type::getInt32PtrTy(*Context));
unsigned Idx = MF.getConstantPool()->getConstantPoolIndex(CPV, Align);
}
bool ARMPreAllocLoadStoreOpt::runOnMachineFunction(MachineFunction &Fn) {
- TD = Fn.getTarget().getDataLayout();
+ TD = &Fn.getDataLayout();
STI = &static_cast<const ARMSubtarget &>(Fn.getSubtarget());
TII = STI->getInstrInfo();
TRI = STI->getRegisterInfo();
if (Kind.isBSS() || Kind.isDataNoRel() || Kind.isCommon()) {
Type *Ty = GV->getType()->getElementType();
- return IsInSmallSection(TM.getDataLayout()->getTypeAllocSize(Ty));
+ return IsInSmallSection(
+ GV->getParent()->getDataLayout().getTypeAllocSize(Ty));
}
return false;
MCSymbol *MSP430MCInstLower::
GetJumpTableSymbol(const MachineOperand &MO) const {
- const DataLayout *DL = Printer.TM.getDataLayout();
+ const DataLayout &DL = Printer.getDataLayout();
SmallString<256> Name;
- raw_svector_ostream(Name) << DL->getPrivateGlobalPrefix() << "JTI"
+ raw_svector_ostream(Name) << DL.getPrivateGlobalPrefix() << "JTI"
<< Printer.getFunctionNumber() << '_'
<< MO.getIndex();
MCSymbol *MSP430MCInstLower::
GetConstantPoolIndexSymbol(const MachineOperand &MO) const {
- const DataLayout *DL = Printer.TM.getDataLayout();
+ const DataLayout &DL = Printer.getDataLayout();
SmallString<256> Name;
- raw_svector_ostream(Name) << DL->getPrivateGlobalPrefix() << "CPI"
+ raw_svector_ostream(Name) << DL.getPrivateGlobalPrefix() << "CPI"
<< Printer.getFunctionNumber() << '_'
<< MO.getIndex();
if (MCPE.isMachineConstantPoolEntry())
EmitMachineConstantPoolValue(MCPE.Val.MachineCPVal);
else
- EmitGlobalConstant(MCPE.Val.ConstVal);
+ EmitGlobalConstant(MF->getDataLayout(), MCPE.Val.ConstVal);
return;
}
void MipsAsmPrinter::printOperand(const MachineInstr *MI, int opNum,
raw_ostream &O) {
- const DataLayout *DL = TM.getDataLayout();
const MachineOperand &MO = MI->getOperand(opNum);
bool closeP = false;
}
case MachineOperand::MO_ConstantPoolIndex:
- O << DL->getPrivateGlobalPrefix() << "CPI"
+ O << getDataLayout().getPrivateGlobalPrefix() << "CPI"
<< getFunctionNumber() << "_" << MO.getIndex();
if (MO.getOffset())
O << "+" << MO.getOffset();
// identity mapping of CPI's to CPE's.
const std::vector<MachineConstantPoolEntry> &CPs = MCP->getConstants();
- const DataLayout &TD = *MF->getTarget().getDataLayout();
+ const DataLayout &TD = MF->getDataLayout();
for (unsigned i = 0, e = CPs.size(); i != e; ++i) {
unsigned Size = TD.getTypeAllocSize(CPs[i].getType());
assert(Size >= 4 && "Too small constant pool entry");
if (DisableBackwardSearch)
return false;
- RegDefsUses RegDU(*MBB.getParent()->getSubtarget().getRegisterInfo());
- MemDefsUses MemDU(*TM.getDataLayout(), MBB.getParent()->getFrameInfo());
+ auto *Fn = MBB.getParent();
+ RegDefsUses RegDU(*Fn->getSubtarget().getRegisterInfo());
+ MemDefsUses MemDU(Fn->getDataLayout(), Fn->getFrameInfo());
ReverseIter Filler;
RegDU.init(*Slot);
BB2BrMap BrMap;
std::unique_ptr<InspectMemInstr> IM;
Iter Filler;
+ auto *Fn = MBB.getParent();
// Iterate over SuccBB's predecessor list.
for (MachineBasicBlock::pred_iterator PI = SuccBB->pred_begin(),
// Do not allow moving instructions which have unallocatable register operands
// across basic block boundaries.
- RegDU.setUnallocatableRegs(*MBB.getParent());
+ RegDU.setUnallocatableRegs(*Fn);
// Only allow moving loads from stack or constants if any of the SuccBB's
// predecessors have multiple successors.
if (HasMultipleSuccs) {
IM.reset(new LoadFromStackOrConst());
} else {
- const MachineFrameInfo *MFI = MBB.getParent()->getFrameInfo();
- IM.reset(new MemDefsUses(*TM.getDataLayout(), MFI));
+ const MachineFrameInfo *MFI = Fn->getFrameInfo();
+ IM.reset(new MemDefsUses(Fn->getDataLayout(), MFI));
}
if (!searchRange(MBB, SuccBB->begin(), SuccBB->end(), RegDU, *IM, Slot,
static_cast<const MipsTargetObjectFile *>(
getTargetMachine().getObjFileLowering());
- if (TLOF->IsConstantInSmallSection(N->getConstVal(), getTargetMachine()))
+ if (TLOF->IsConstantInSmallSection(DAG.getDataLayout(), N->getConstVal(),
+ getTargetMachine()))
// %gp_rel relocation
return getAddrGPRel(N, SDLoc(N), Ty, DAG);
}
/// Return true if this constant should be placed into small data section.
-bool MipsTargetObjectFile::
-IsConstantInSmallSection(const Constant *CN, const TargetMachine &TM) const {
+bool MipsTargetObjectFile::IsConstantInSmallSection(
+ const DataLayout &DL, const Constant *CN, const TargetMachine &TM) const {
return (static_cast<const MipsTargetMachine &>(TM)
.getSubtargetImpl()
->useSmallSection() &&
- LocalSData && IsInSmallSection(TM.getDataLayout()->getTypeAllocSize(
- CN->getType())));
+ LocalSData && IsInSmallSection(DL.getTypeAllocSize(CN->getType())));
}
/// Return true if this constant should be placed into small data section.
MCSection *MipsTargetObjectFile::getSectionForConstant(
const DataLayout &DL, SectionKind Kind, const Constant *C) const {
- if (IsConstantInSmallSection(C, *TM))
+ if (IsConstantInSmallSection(DL, C, *TM))
return SmallDataSection;
// Otherwise, we work the same as ELF.
const TargetMachine &TM) const override;
/// Return true if this constant should be placed into small data section.
- bool IsConstantInSmallSection(const Constant *CN,
+ bool IsConstantInSmallSection(const DataLayout &DL, const Constant *CN,
const TargetMachine &TM) const;
MCSection *getSectionForConstant(const DataLayout &DL, SectionKind Kind,
GVar->getName().startswith("nvvm."))
return;
- const DataLayout *TD = TM.getDataLayout();
+ const DataLayout &DL = getDataLayout();
// GlobalVariables are always constant pointers themselves.
const PointerType *PTy = GVar->getType();
}
if (GVar->getAlignment() == 0)
- O << " .align " << (int) TD->getPrefTypeAlignment(ETy);
+ O << " .align " << (int)DL.getPrefTypeAlignment(ETy);
else
O << " .align " << GVar->getAlignment();
case Type::StructTyID:
case Type::ArrayTyID:
case Type::VectorTyID:
- ElementSize = TD->getTypeStoreSize(ETy);
+ ElementSize = DL.getTypeStoreSize(ETy);
// Ptx allows variable initilization only for constant and
// global state spaces.
if (((PTy->getAddressSpace() == llvm::ADDRESS_SPACE_GLOBAL) ||
void NVPTXAsmPrinter::emitPTXGlobalVariable(const GlobalVariable *GVar,
raw_ostream &O) {
- const DataLayout *TD = TM.getDataLayout();
+ const DataLayout &DL = getDataLayout();
// GlobalVariables are always constant pointers themselves.
const PointerType *PTy = GVar->getType();
O << ".";
emitPTXAddressSpace(PTy->getAddressSpace(), O);
if (GVar->getAlignment() == 0)
- O << " .align " << (int) TD->getPrefTypeAlignment(ETy);
+ O << " .align " << (int)DL.getPrefTypeAlignment(ETy);
else
O << " .align " << GVar->getAlignment();
case Type::StructTyID:
case Type::ArrayTyID:
case Type::VectorTyID:
- ElementSize = TD->getTypeStoreSize(ETy);
+ ElementSize = DL.getTypeStoreSize(ETy);
O << " .b8 ";
getSymbol(GVar)->print(O, MAI);
O << "[";
return;
}
-static unsigned int getOpenCLAlignment(const DataLayout *TD, Type *Ty) {
+static unsigned int getOpenCLAlignment(const DataLayout &DL, Type *Ty) {
if (Ty->isSingleValueType())
- return TD->getPrefTypeAlignment(Ty);
+ return DL.getPrefTypeAlignment(Ty);
const ArrayType *ATy = dyn_cast<ArrayType>(Ty);
if (ATy)
- return getOpenCLAlignment(TD, ATy->getElementType());
+ return getOpenCLAlignment(DL, ATy->getElementType());
const StructType *STy = dyn_cast<StructType>(Ty);
if (STy) {
// largest alignment.
for (unsigned i = 0, e = STy->getNumElements(); i != e; i++) {
Type *ETy = STy->getElementType(i);
- unsigned int align = getOpenCLAlignment(TD, ETy);
+ unsigned int align = getOpenCLAlignment(DL, ETy);
if (align > alignStruct)
alignStruct = align;
}
const FunctionType *FTy = dyn_cast<FunctionType>(Ty);
if (FTy)
- return TD->getPointerPrefAlignment();
- return TD->getPrefTypeAlignment(Ty);
+ return DL.getPointerPrefAlignment();
+ return DL.getPrefTypeAlignment(Ty);
}
void NVPTXAsmPrinter::printParamName(Function::const_arg_iterator I,
}
void NVPTXAsmPrinter::emitFunctionParamList(const Function *F, raw_ostream &O) {
- const DataLayout *TD = TM.getDataLayout();
+ const DataLayout &DL = getDataLayout();
const AttributeSet &PAL = F->getAttributes();
const TargetLowering *TLI = nvptxSubtarget->getTargetLowering();
Function::const_arg_iterator I, E;
bool first = true;
bool isKernelFunc = llvm::isKernelFunction(*F);
bool isABI = (nvptxSubtarget->getSmVersion() >= 20);
- MVT thePointerTy = TLI->getPointerTy(*TD);
+ MVT thePointerTy = TLI->getPointerTy(DL);
O << "(\n";
// size = typeallocsize of element type
unsigned align = PAL.getParamAlignment(paramIndex + 1);
if (align == 0)
- align = TD->getABITypeAlignment(Ty);
+ align = DL.getABITypeAlignment(Ty);
- unsigned sz = TD->getTypeAllocSize(Ty);
+ unsigned sz = DL.getTypeAllocSize(Ty);
O << "\t.param .align " << align << " .b8 ";
printParamName(I, paramIndex, O);
O << "[" << sz << "]";
O << ".ptr .global ";
break;
}
- O << ".align " << (int) getOpenCLAlignment(TD, ETy) << " ";
+ O << ".align " << (int)getOpenCLAlignment(DL, ETy) << " ";
}
printParamName(I, paramIndex, O);
continue;
// size = typeallocsize of element type
unsigned align = PAL.getParamAlignment(paramIndex + 1);
if (align == 0)
- align = TD->getABITypeAlignment(ETy);
+ align = DL.getABITypeAlignment(ETy);
- unsigned sz = TD->getTypeAllocSize(ETy);
+ unsigned sz = DL.getTypeAllocSize(ETy);
O << "\t.param .align " << align << " .b8 ";
printParamName(I, paramIndex, O);
O << "[" << sz << "]";
// Further, if a part is vector, print the above for
// each vector element.
SmallVector<EVT, 16> vtparts;
- ComputeValueVTs(*TLI, getDataLayout(), ETy, vtparts);
+ ComputeValueVTs(*TLI, DL, ETy, vtparts);
for (unsigned i = 0, e = vtparts.size(); i != e; ++i) {
unsigned elems = 1;
EVT elemtype = vtparts[i];
void NVPTXAsmPrinter::bufferLEByte(const Constant *CPV, int Bytes,
AggBuffer *aggBuffer) {
- const DataLayout *TD = TM.getDataLayout();
+ const DataLayout &DL = getDataLayout();
if (isa<UndefValue>(CPV) || CPV->isNullValue()) {
- int s = TD->getTypeAllocSize(CPV->getType());
+ int s = DL.getTypeAllocSize(CPV->getType());
if (s < Bytes)
s = Bytes;
aggBuffer->addZeros(s);
break;
} else if (const ConstantExpr *Cexpr = dyn_cast<ConstantExpr>(CPV)) {
if (const ConstantInt *constInt = dyn_cast<ConstantInt>(
- ConstantFoldConstantExpression(Cexpr, *TD))) {
+ ConstantFoldConstantExpression(Cexpr, DL))) {
int int32 = (int)(constInt->getZExtValue());
ConvertIntToBytes<>(ptr, int32);
aggBuffer->addBytes(ptr, 4, Bytes);
break;
} else if (const ConstantExpr *Cexpr = dyn_cast<ConstantExpr>(CPV)) {
if (const ConstantInt *constInt = dyn_cast<ConstantInt>(
- ConstantFoldConstantExpression(Cexpr, *TD))) {
+ ConstantFoldConstantExpression(Cexpr, DL))) {
long long int64 = (long long)(constInt->getZExtValue());
ConvertIntToBytes<>(ptr, int64);
aggBuffer->addBytes(ptr, 8, Bytes);
const Value *v = Cexpr->stripPointerCasts();
aggBuffer->addSymbol(v, Cexpr);
}
- unsigned int s = TD->getTypeAllocSize(CPV->getType());
+ unsigned int s = DL.getTypeAllocSize(CPV->getType());
aggBuffer->addZeros(s);
break;
}
case Type::StructTyID: {
if (isa<ConstantArray>(CPV) || isa<ConstantVector>(CPV) ||
isa<ConstantStruct>(CPV) || isa<ConstantDataSequential>(CPV)) {
- int ElementSize = TD->getTypeAllocSize(CPV->getType());
+ int ElementSize = DL.getTypeAllocSize(CPV->getType());
bufferAggregateConstant(CPV, aggBuffer);
if (Bytes > ElementSize)
aggBuffer->addZeros(Bytes - ElementSize);
void NVPTXAsmPrinter::bufferAggregateConstant(const Constant *CPV,
AggBuffer *aggBuffer) {
- const DataLayout *TD = TM.getDataLayout();
+ const DataLayout &DL = getDataLayout();
int Bytes;
// Old constants
StructType *ST = cast<StructType>(CPV->getType());
for (unsigned i = 0, e = CPV->getNumOperands(); i != e; ++i) {
if (i == (e - 1))
- Bytes = TD->getStructLayout(ST)->getElementOffset(0) +
- TD->getTypeAllocSize(ST) -
- TD->getStructLayout(ST)->getElementOffset(i);
+ Bytes = DL.getStructLayout(ST)->getElementOffset(0) +
+ DL.getTypeAllocSize(ST) -
+ DL.getStructLayout(ST)->getElementOffset(i);
else
- Bytes = TD->getStructLayout(ST)->getElementOffset(i + 1) -
- TD->getStructLayout(ST)->getElementOffset(i);
+ Bytes = DL.getStructLayout(ST)->getElementOffset(i + 1) -
+ DL.getStructLayout(ST)->getElementOffset(i);
bufferLEByte(cast<Constant>(CPV->getOperand(i)), Bytes, aggBuffer);
}
}
// If the code isn't optimized, there may be outstanding folding
// opportunities. Attempt to fold the expression using DataLayout as a
// last resort before giving up.
- if (Constant *C = ConstantFoldConstantExpression(CE, *TM.getDataLayout()))
+ if (Constant *C = ConstantFoldConstantExpression(CE, getDataLayout()))
if (C != CE)
return lowerConstantForGV(C, ProcessingGeneric);
}
case Instruction::GetElementPtr: {
- const DataLayout &DL = *TM.getDataLayout();
+ const DataLayout &DL = getDataLayout();
// Generate a symbolic expression for the byte address
APInt OffsetAI(DL.getPointerTypeSizeInBits(CE->getType()), 0);
return lowerConstantForGV(CE->getOperand(0), ProcessingGeneric);
case Instruction::IntToPtr: {
- const DataLayout &DL = *TM.getDataLayout();
+ const DataLayout &DL = getDataLayout();
// Handle casts to pointers by changing them into casts to the appropriate
// integer type. This promotes constant folding and simplifies this code.
}
case Instruction::PtrToInt: {
- const DataLayout &DL = *TM.getDataLayout();
+ const DataLayout &DL = getDataLayout();
// Support only foldable casts to/from pointers that can be eliminated by
// changing the pointer to the appropriately sized integer type.
void PPCAsmPrinter::printOperand(const MachineInstr *MI, unsigned OpNo,
raw_ostream &O) {
- const DataLayout *DL = TM.getDataLayout();
+ const DataLayout &DL = getDataLayout();
const MachineOperand &MO = MI->getOperand(OpNo);
switch (MO.getType()) {
MO.getMBB()->getSymbol()->print(O, MAI);
return;
case MachineOperand::MO_ConstantPoolIndex:
- O << DL->getPrivateGlobalPrefix() << "CPI" << getFunctionNumber()
- << '_' << MO.getIndex();
+ O << DL.getPrivateGlobalPrefix() << "CPI" << getFunctionNumber() << '_'
+ << MO.getIndex();
return;
case MachineOperand::MO_BlockAddress:
GetBlockAddressSymbol(MO.getBlockAddress())->print(O, MAI);
bool PPCLinuxAsmPrinter::doFinalization(Module &M) {
- const DataLayout *TD = TM.getDataLayout();
+ const DataLayout &DL = getDataLayout();
- bool isPPC64 = TD->getPointerSizeInBits() == 64;
+ bool isPPC64 = DL.getPointerSizeInBits() == 64;
PPCTargetStreamer &TS =
static_cast<PPCTargetStreamer &>(*OutStreamer->getTargetStreamer());
void PPCDarwinAsmPrinter::
EmitFunctionStubs(const MachineModuleInfoMachO::SymbolListTy &Stubs) {
- bool isPPC64 = TM.getDataLayout()->getPointerSizeInBits() == 64;
+ bool isPPC64 = getDataLayout().getPointerSizeInBits() == 64;
// Construct a local MCSubtargetInfo and shadow EmitToStreamer here.
// This is because the MachineFunction won't exist (but have not yet been
bool PPCDarwinAsmPrinter::doFinalization(Module &M) {
- bool isPPC64 = TM.getDataLayout()->getPointerSizeInBits() == 64;
+ bool isPPC64 = getDataLayout().getPointerSizeInBits() == 64;
// Darwin/PPC always uses mach-o.
const TargetLoweringObjectFileMachO &TLOFMacho =
static MCSymbol *GetSymbolFromOperand(const MachineOperand &MO, AsmPrinter &AP){
const TargetMachine &TM = AP.TM;
Mangler *Mang = AP.Mang;
- const DataLayout *DL = TM.getDataLayout();
+ const DataLayout &DL = AP.getDataLayout();
MCContext &Ctx = AP.OutContext;
bool isDarwin = TM.getTargetTriple().isOSDarwin();
Suffix = "$non_lazy_ptr";
if (!Suffix.empty())
- Name += DL->getPrivateGlobalPrefix();
+ Name += DL.getPrivateGlobalPrefix();
unsigned PrefixLen = Name.size();
if (!MO.isGlobal()) {
assert(MO.isSymbol() && "Isn't a symbol reference");
- Mangler::getNameWithPrefix(Name, MO.getSymbolName(), *DL);
+ Mangler::getNameWithPrefix(Name, MO.getSymbolName(), DL);
} else {
const GlobalValue *GV = MO.getGlobal();
TM.getNameWithPrefix(Name, GV, *Mang);
void PPCFunctionInfo::anchor() { }
MCSymbol *PPCFunctionInfo::getPICOffsetSymbol() const {
- const DataLayout *DL = MF.getTarget().getDataLayout();
- return MF.getContext().getOrCreateSymbol(Twine(DL->getPrivateGlobalPrefix()) +
+ const DataLayout &DL = MF.getDataLayout();
+ return MF.getContext().getOrCreateSymbol(Twine(DL.getPrivateGlobalPrefix()) +
Twine(MF.getFunctionNumber()) +
"$poff");
}
void SparcAsmPrinter::printOperand(const MachineInstr *MI, int opNum,
raw_ostream &O) {
- const DataLayout *DL = TM.getDataLayout();
+ const DataLayout &DL = getDataLayout();
const MachineOperand &MO = MI->getOperand (opNum);
SparcMCExpr::VariantKind TF = (SparcMCExpr::VariantKind) MO.getTargetFlags();
O << MO.getSymbolName();
break;
case MachineOperand::MO_ConstantPoolIndex:
- O << DL->getPrivateGlobalPrefix() << "CPI" << getFunctionNumber() << "_"
+ O << DL.getPrivateGlobalPrefix() << "CPI" << getFunctionNumber() << "_"
<< MO.getIndex();
break;
default:
MCSymbolRefExpr::create(getSymbol(ZCPV->getGlobalValue()),
getModifierVariantKind(ZCPV->getModifier()),
OutContext);
- uint64_t Size = TM.getDataLayout()->getTypeAllocSize(ZCPV->getType());
+ uint64_t Size = getDataLayout().getTypeAllocSize(ZCPV->getType());
OutStreamer->EmitValue(Expr, Size);
}
/// operand to an MCSymbol.
MCSymbol *X86MCInstLower::
GetSymbolFromOperand(const MachineOperand &MO) const {
- const DataLayout *DL = TM.getDataLayout();
+ const DataLayout &DL = MF.getDataLayout();
assert((MO.isGlobal() || MO.isSymbol() || MO.isMBB()) && "Isn't a symbol reference");
MCSymbol *Sym = nullptr;
}
if (!Suffix.empty())
- Name += DL->getPrivateGlobalPrefix();
+ Name += DL.getPrivateGlobalPrefix();
unsigned PrefixLen = Name.size();
const GlobalValue *GV = MO.getGlobal();
AsmPrinter.getNameWithPrefix(Name, GV);
} else if (MO.isSymbol()) {
- Mangler::getNameWithPrefix(Name, MO.getSymbolName(), *DL);
+ Mangler::getNameWithPrefix(Name, MO.getSymbolName(), DL);
} else if (MO.isMBB()) {
assert(Suffix.empty());
Sym = MO.getMBB()->getSymbol();
EmitSpecialLLVMGlobal(GV))
return;
- const DataLayout *TD = TM.getDataLayout();
+ const DataLayout &DL = getDataLayout();
OutStreamer->SwitchSection(
getObjFileLowering().SectionForGlobal(GV, *Mang, TM));
MCSymbol *GVSym = getSymbol(GV);
const Constant *C = GV->getInitializer();
- unsigned Align = (unsigned)TD->getPreferredTypeAlignmentShift(C->getType());
-
+ unsigned Align = (unsigned)DL.getPreferredTypeAlignmentShift(C->getType());
+
// Mark the start of the global
getTargetStreamer().emitCCTopData(GVSym->getName());
if (GV->isThreadLocal()) {
report_fatal_error("TLS is not supported by this target!");
}
- unsigned Size = TD->getTypeAllocSize(C->getType());
+ unsigned Size = DL.getTypeAllocSize(C->getType());
if (MAI->hasDotTypeDotSizeDirective()) {
OutStreamer->EmitSymbolAttribute(GVSym, MCSA_ELF_TypeObject);
OutStreamer->emitELFSize(cast<MCSymbolELF>(GVSym),
MCConstantExpr::create(Size, OutContext));
}
OutStreamer->EmitLabel(GVSym);
-
- EmitGlobalConstant(C);
+
+ EmitGlobalConstant(DL, C);
// The ABI requires that unsigned scalar types smaller than 32 bits
// are padded to 32 bits.
if (Size < 4)
void XCoreAsmPrinter::printOperand(const MachineInstr *MI, int opNum,
raw_ostream &O) {
- const DataLayout *DL = TM.getDataLayout();
+ const DataLayout &DL = getDataLayout();
const MachineOperand &MO = MI->getOperand(opNum);
switch (MO.getType()) {
case MachineOperand::MO_Register:
getSymbol(MO.getGlobal())->print(O, MAI);
break;
case MachineOperand::MO_ConstantPoolIndex:
- O << DL->getPrivateGlobalPrefix() << "CPI" << getFunctionNumber()
- << '_' << MO.getIndex();
+ O << DL.getPrivateGlobalPrefix() << "CPI" << getFunctionNumber() << '_'
+ << MO.getIndex();
break;
case MachineOperand::MO_BlockAddress:
GetBlockAddressSymbol(MO.getBlockAddress())->print(O, MAI);
if (Kind.isMergeableConst16()) return MergeableConst16Section;
}
Type *ObjType = GV->getType()->getPointerElementType();
+ auto &DL = GV->getParent()->getDataLayout();
if (TM.getCodeModel() == CodeModel::Small || !ObjType->isSized() ||
- TM.getDataLayout()->getTypeAllocSize(ObjType) < CodeModelLargeSize) {
+ DL.getTypeAllocSize(ObjType) < CodeModelLargeSize) {
if (Kind.isReadOnly()) return UseCPRel? ReadOnlySection
: DataRelROSection;
if (Kind.isBSS() || Kind.isCommon())return BSSSection;
O << Size << ", ";
else
O << "\n" << IndentStr
- << " State.getMachineFunction().getTarget().getDataLayout()"
- "->getTypeAllocSize(EVT(LocVT).getTypeForEVT(State.getContext())),"
+ << " State.getMachineFunction().getDataLayout()."
+ "getTypeAllocSize(EVT(LocVT).getTypeForEVT(State.getContext())),"
" ";
if (Align)
O << Align;
else
O << "\n" << IndentStr
- << " State.getMachineFunction().getTarget().getDataLayout()"
- "->getABITypeAlignment(EVT(LocVT).getTypeForEVT(State.getContext()"
+ << " State.getMachineFunction().getDataLayout()."
+ "getABITypeAlignment(EVT(LocVT).getTypeForEVT(State.getContext()"
"))";
O << ");\n" << IndentStr
<< "State.addLoc(CCValAssign::getMem(ValNo, ValVT, Offset"
projects / oota-llvm.git / commitdiff